C26H20F3N3O2 — CID 175362644
N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-2-fluoro-N-methyl-4-phenylbenzamide (PubChem CID 175362644) has the molecular formula C26H20F3N3O2 and a molecular weight of 463.46 g/mol. Its IUPAC name is N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-2-fluoro-N-methyl-4-phenylbenzamide.
| Compound Name | N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-2-fluoro-N-methyl-4-phenylbenzamide |
|---|---|
| PubChem CID | 175362644 |
| Molecular Formula | C26H20F3N3O2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-2-fluoro-N-methyl-4-phenylbenzamide |
| SMILES | CN(C(=O)c1ccc(-c2ccccc2)cc1F)[C@H]1CNCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C26H20F3N3O2/c1-32(26(34)16-8-7-15(9-19(16)27)14-5-3-2-4-6-14)23-13-30-12-22-24(23)17-10-20(28)21(29)11-18(17)25(33)31-22/h2-11,23,30H,12-13H2,1H3,(H,31,33)/t23-/m0/s1 |
| InChIKey | PVNRHDVTLDUIBW-QHCPKHFHSA-N |
| XLogP | 4.53 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |