C22H17F3N4O2 — CID 171750638
N-(8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl)-4-fluoro-N-methyl-7aH-indole-2-carboxamide (PubChem CID 171750638) has the molecular formula C22H17F3N4O2 and a molecular weight of 426.40 g/mol. Its IUPAC name is N-(8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl)-4-fluoro-N-methyl-7aH-indole-2-carboxamide.
| Compound Name | N-(8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl)-4-fluoro-N-methyl-7aH-indole-2-carboxamide |
|---|---|
| PubChem CID | 171750638 |
| Molecular Formula | C22H17F3N4O2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-(8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl)-4-fluoro-N-methyl-7aH-indole-2-carboxamide |
| SMILES | CN(C(=O)C1=NC2C=CC=C(F)C2=C1)C1CNCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C22H17F3N4O2/c1-29(22(31)17-7-12-13(23)3-2-4-16(12)27-17)19-9-26-8-18-20(19)10-5-14(24)15(25)6-11(10)21(30)28-18/h2-7,16,19,26H,8-9H2,1H3,(H,28,30) |
| InChIKey | CFYBKXZJZWFLDY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |