C24H22F2N4O3 — CID 166526267
N-[(1R)-8,9-difluoro-3-(2-hydroxyethyl)-6-oxo-1,2,4,5-tetrahydrobenzo[c][1,7]naphthyridin-1-yl]-N-methyl-1H-indole-2-carboxamide (PubChem CID 166526267) has the molecular formula C24H22F2N4O3 and a molecular weight of 452.46 g/mol. Its IUPAC name is N-[(1R)-8,9-difluoro-3-(2-hydroxyethyl)-6-oxo-1,2,4,5-tetrahydrobenzo[c][1,7]naphthyridin-1-yl]-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-[(1R)-8,9-difluoro-3-(2-hydroxyethyl)-6-oxo-1,2,4,5-tetrahydrobenzo[c][1,7]naphthyridin-1-yl]-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166526267 |
| Molecular Formula | C24H22F2N4O3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[(1R)-8,9-difluoro-3-(2-hydroxyethyl)-6-oxo-1,2,4,5-tetrahydrobenzo[c][1,7]naphthyridin-1-yl]-N-methyl-1H-indole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2ccccc2[nH]1)[C@H]1CN(CCO)Cc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C24H22F2N4O3/c1-29(24(33)19-8-13-4-2-3-5-18(13)27-19)21-12-30(6-7-31)11-20-22(21)14-9-16(25)17(26)10-15(14)23(32)28-20/h2-5,8-10,21,27,31H,6-7,11-12H2,1H3,(H,28,32)/t21-/m0/s1 |
| InChIKey | GXWDVLQSKBTNLG-NRFANRHFSA-N |
| XLogP | 2.91 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |