C20H14F5N3O4 — CID 166526449
N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methyl-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxamide (PubChem CID 166526449) has the molecular formula C20H14F5N3O4 and a molecular weight of 455.34 g/mol. Its IUPAC name is N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methyl-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxamide.
| Compound Name | N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methyl-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166526449 |
| Molecular Formula | C20H14F5N3O4 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-[(1S)-8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl]-N-methyl-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(C(F)(F)F)c(=O)[nH]1)[C@@H]1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C20H14F5N3O4/c1-28(19(31)13-3-2-10(18(30)26-13)20(23,24)25)15-7-32-6-14-16(15)8-4-11(21)12(22)5-9(8)17(29)27-14/h2-5,15H,6-7H2,1H3,(H,26,30)(H,27,29)/t15-/m1/s1 |
| InChIKey | YLZWWEGIDNOELR-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |