C22H15F5N4O3 — CID 166526968
N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 166526968) has the molecular formula C22H15F5N4O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166526968 |
| Molecular Formula | C22H15F5N4O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | N-(8,9-difluoro-6-oxo-1,2,4,5-tetrahydropyrano[3,4-c]isoquinolin-1-yl)-N-methyl-5-(trifluoromethyl)-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CN(C(=O)c1cc2cc(C(F)(F)F)ncc2[nH]1)C1COCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C22H15F5N4O3/c1-31(21(33)14-2-9-3-18(22(25,26)27)28-6-15(9)29-14)17-8-34-7-16-19(17)10-4-12(23)13(24)5-11(10)20(32)30-16/h2-6,17,29H,7-8H2,1H3,(H,30,32) |
| InChIKey | KUNCSJLWFKFVPL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |