C21H26B3N7O3 — CID 166528187
CID 166528187 (PubChem CID 166528187) has the molecular formula C21H26B3N7O3 and a molecular weight of 456.92 g/mol.
| Compound Name | CID 166528187 |
|---|---|
| PubChem CID | 166528187 |
| Molecular Formula | C21H26B3N7O3 |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | — |
| SMILES | CC1(O)CCC1.CC1CCOC1.[B]C([B])([B])n1cc(Nc2ncc3cc(C#N)[nH]c3n2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H6B3N7O.2C5H10O/c12-11(13,14)21-4-7(9(22)20-21)18-10-16-3-5-1-6(2-15)17-8(5)19-10;1-5-2-3-6-4-5;1-5(6)3-2-4-5/h1,3-4H,(H,20,22)(H2,16,17,18,19);5H,2-4H2,1H3;6H,2-4H2,1H3 |
| InChIKey | XECFBOFJAORJJE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 144.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|