C19H12BF7N2O2 — CID 166529349
CID 166529349 (PubChem CID 166529349) has the molecular formula C19H12BF7N2O2 and a molecular weight of 444.12 g/mol.
| Compound Name | CID 166529349 |
|---|---|
| PubChem CID | 166529349 |
| Molecular Formula | C19H12BF7N2O2 |
| Molecular Weight | 444.12 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(F)(F)F)cc([C@]2(C(F)(F)F)CC(c3ccc(C(N)=O)c(C)c3)=NO2)c1F |
| InChI | InChI=1S/C19H12BF7N2O2/c1-8-4-9(2-3-11(8)16(28)30)14-7-17(31-29-14,19(25,26)27)12-5-10(18(22,23)24)6-13(20)15(12)21/h2-6H,7H2,1H3,(H2,28,30)/t17-/m0/s1 |
| InChIKey | VCJPZDABIJFQMK-KRWDZBQOSA-N |
| XLogP | 3.63 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.12 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|