C9H15N5 — CID 16653160
2-piperidin-1-ylpyrimidine-4,6-diamine (PubChem CID 16653160) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-piperidin-1-ylpyrimidine-4,6-diamine.
| Compound Name | 2-piperidin-1-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 16653160 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-piperidin-1-ylpyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C9H15N5/c10-7-6-8(11)13-9(12-7)14-4-2-1-3-5-14/h6H,1-5H2,(H4,10,11,12,13) |
| InChIKey | VMRLTXDXQQGXMR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |