C21H24N2O4S — CID 166532501
1-[2-methyl-1-(3-methyl-1-benzofuran-2-yl)propyl]-3-(4-methylsulfonylphenyl)urea (PubChem CID 166532501) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[2-methyl-1-(3-methyl-1-benzofuran-2-yl)propyl]-3-(4-methylsulfonylphenyl)urea.
| Compound Name | 1-[2-methyl-1-(3-methyl-1-benzofuran-2-yl)propyl]-3-(4-methylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 166532501 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[2-methyl-1-(3-methyl-1-benzofuran-2-yl)propyl]-3-(4-methylsulfonylphenyl)urea |
| SMILES | Cc1c(C(NC(=O)Nc2ccc(S(C)(=O)=O)cc2)C(C)C)oc2ccccc12 |
| InChI | InChI=1S/C21H24N2O4S/c1-13(2)19(20-14(3)17-7-5-6-8-18(17)27-20)23-21(24)22-15-9-11-16(12-10-15)28(4,25)26/h5-13,19H,1-4H3,(H2,22,23,24) |
| InChIKey | HPISWNCCGPSOFD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |