C18H19N3O4S — CID 166532279
1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(6-methylsulfonyl-3-pyridinyl)urea (PubChem CID 166532279) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(6-methylsulfonyl-3-pyridinyl)urea.
| Compound Name | 1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(6-methylsulfonyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 166532279 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(6-methylsulfonyl-3-pyridinyl)urea |
| SMILES | Cc1c(C(C)NC(=O)Nc2ccc(S(C)(=O)=O)nc2)oc2ccccc12 |
| InChI | InChI=1S/C18H19N3O4S/c1-11-14-6-4-5-7-15(14)25-17(11)12(2)20-18(22)21-13-8-9-16(19-10-13)26(3,23)24/h4-10,12H,1-3H3,(H2,20,21,22) |
| InChIKey | XHFSBATWRYTKCO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |