C17H15F5N6O — CID 166533082
1-(2-aminopyrimidin-5-yl)-3-[(1R)-1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethyl]urea (PubChem CID 166533082) has the molecular formula C17H15F5N6O and a molecular weight of 414.34 g/mol. Its IUPAC name is 1-(2-aminopyrimidin-5-yl)-3-[(1R)-1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethyl]urea.
| Compound Name | 1-(2-aminopyrimidin-5-yl)-3-[(1R)-1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethyl]urea |
|---|---|
| PubChem CID | 166533082 |
| Molecular Formula | C17H15F5N6O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-(2-aminopyrimidin-5-yl)-3-[(1R)-1-(5,7-difluoro-1,3-dimethylindol-2-yl)-2,2,2-trifluoroethyl]urea |
| SMILES | Cc1c([C@@H](NC(=O)Nc2cnc(N)nc2)C(F)(F)F)n(C)c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C17H15F5N6O/c1-7-10-3-8(18)4-11(19)13(10)28(2)12(7)14(17(20,21)22)27-16(29)26-9-5-24-15(23)25-6-9/h3-6,14H,1-2H3,(H2,23,24,25)(H2,26,27,29)/t14-/m1/s1 |
| InChIKey | VUEALZAIULQNGW-CQSZACIVSA-N |
| XLogP | 3.56 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|