C9H8Cl2FN — CID 166534513
3-(2,6-dichlorophenyl)-3-fluoroazetidine (PubChem CID 166534513) has the molecular formula C9H8Cl2FN and a molecular weight of 220.07 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-3-fluoroazetidine.
| Compound Name | 3-(2,6-dichlorophenyl)-3-fluoroazetidine |
|---|---|
| PubChem CID | 166534513 |
| Molecular Formula | C9H8Cl2FN |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-3-fluoroazetidine |
| SMILES | FC1(c2c(Cl)cccc2Cl)CNC1 |
| InChI | InChI=1S/C9H8Cl2FN/c10-6-2-1-3-7(11)8(6)9(12)4-13-5-9/h1-3,13H,4-5H2 |
| InChIKey | DGAFJRCTCXKQNO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |