C21H31N5O3 — CID 16653945
2-[1-[2-(4-ethylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(2-methylphenyl)acetamide (PubChem CID 16653945) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[1-[2-(4-ethylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[1-[2-(4-ethylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16653945 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-[1-[2-(4-ethylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(2-methylphenyl)acetamide |
| SMILES | CCN1CCN(CC(=O)N2CCNC(=O)C2CC(=O)Nc2ccccc2C)CC1 |
| InChI | InChI=1S/C21H31N5O3/c1-3-24-10-12-25(13-11-24)15-20(28)26-9-8-22-21(29)18(26)14-19(27)23-17-7-5-4-6-16(17)2/h4-7,18H,3,8-15H2,1-2H3,(H,22,29)(H,23,27) |
| InChIKey | BZXGJIYCJCYQKO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |