C24H22ClFN6O2 — CID 166539763
(E)-3-[(1S,4S)-5-[4-(3-chloro-4-cyclopropyloxy-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-enal (PubChem CID 166539763) has the molecular formula C24H22ClFN6O2 and a molecular weight of 480.93 g/mol. Its IUPAC name is (E)-3-[(1S,4S)-5-[4-(3-chloro-4-cyclopropyloxy-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-enal.
| Compound Name | (E)-3-[(1S,4S)-5-[4-(3-chloro-4-cyclopropyloxy-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 166539763 |
| Molecular Formula | C24H22ClFN6O2 |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (E)-3-[(1S,4S)-5-[4-(3-chloro-4-cyclopropyloxy-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-enal |
| SMILES | O=C/C=C/N1C[C@@H]2C[C@H]1CN2c1ccc2ncnc(Nc3ccc(OC4CC4)c(Cl)c3F)c2n1 |
| InChI | InChI=1S/C24H22ClFN6O2/c25-21-19(34-16-2-3-16)6-4-17(22(21)26)29-24-23-18(27-13-28-24)5-7-20(30-23)32-12-14-10-15(32)11-31(14)8-1-9-33/h1,4-9,13-16H,2-3,10-12H2,(H,27,28,29)/b8-1+/t14-,15-/m0/s1 |
| InChIKey | APLNWTOULQCYKE-RZHDOXHXSA-N |
| XLogP | 4.08 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|