C28H23ClFN9O2 — CID 166544143
1-[(1R,5S)-6-[4-[3-chloro-2-fluoro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,6-diazabicyclo[3.2.1]octan-2-yl]prop-2-en-1-one (PubChem CID 166544143) has the molecular formula C28H23ClFN9O2 and a molecular weight of 572.00 g/mol. Its IUPAC name is 1-[(1R,5S)-6-[4-[3-chloro-2-fluoro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,6-diazabicyclo[3.2.1]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,5S)-6-[4-[3-chloro-2-fluoro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,6-diazabicyclo[3.2.1]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166544143 |
| Molecular Formula | C28H23ClFN9O2 |
| Molecular Weight | 572.00 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 1-[(1R,5S)-6-[4-[3-chloro-2-fluoro-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,6-diazabicyclo[3.2.1]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H]2C[C@@H]1CN2c1ccc2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(Cl)c3F)c2n1 |
| InChI | InChI=1S/C28H23ClFN9O2/c1-2-24(40)37-9-7-16-11-17(37)13-38(16)22-6-4-20-27(36-22)28(33-14-31-20)35-19-3-5-21(25(29)26(19)30)41-18-8-10-39-23(12-18)32-15-34-39/h2-6,8,10,12,14-17H,1,7,9,11,13H2,(H,31,33,35)/t16-,17+/m0/s1 |
| InChIKey | HIHXGLBTZWLXSG-DLBZAZTESA-N |
| XLogP | 4.76 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.00 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|