C28H24FN9O2 — CID 166544210
1-[(1R,4R)-5-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one (PubChem CID 166544210) has the molecular formula C28H24FN9O2 and a molecular weight of 537.56 g/mol. Its IUPAC name is 1-[(1R,4R)-5-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,4R)-5-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166544210 |
| Molecular Formula | C28H24FN9O2 |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 1-[(1R,4R)-5-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H]2C[C@@H]1CN2c1ccc2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(C)c3F)c2n1 |
| InChI | InChI=1S/C28H24FN9O2/c1-3-25(39)37-13-17-10-18(37)12-36(17)23-7-5-21-27(35-23)28(32-14-30-21)34-20-4-6-22(16(2)26(20)29)40-19-8-9-38-24(11-19)31-15-33-38/h3-9,11,14-15,17-18H,1,10,12-13H2,2H3,(H,30,32,34)/t17-,18-/m1/s1 |
| InChIKey | RVUTXZATTPYDBD-QZTJIDSGSA-N |
| XLogP | 4.03 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|