C30H26FN9O2 — CID 166544275
1-[8-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]but-2-yn-1-one (PubChem CID 166544275) has the molecular formula C30H26FN9O2 and a molecular weight of 563.60 g/mol. Its IUPAC name is 1-[8-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]but-2-yn-1-one.
| Compound Name | 1-[8-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 166544275 |
| Molecular Formula | C30H26FN9O2 |
| Molecular Weight | 563.60 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 1-[8-[4-[2-fluoro-3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-3,8-diazabicyclo[3.2.1]octan-3-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CC2CCC(C1)N2c1ccc2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(C)c3F)c2n1 |
| InChI | InChI=1S/C30H26FN9O2/c1-3-4-27(41)38-14-19-5-6-20(15-38)40(19)25-10-8-23-29(37-25)30(34-16-32-23)36-22-7-9-24(18(2)28(22)31)42-21-11-12-39-26(13-21)33-17-35-39/h7-13,16-17,19-20H,5-6,14-15H2,1-2H3,(H,32,34,36) |
| InChIKey | MLGBKWXVAJYSSO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|