C30H28FN9O2 — CID 166544075
N'-[4-[4-[[6-(3-but-2-ynoyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[3,2-d]pyrimidin-4-yl]amino]-3-fluoro-2-methylphenoxy]-2-pyridinyl]methanimidamide (PubChem CID 166544075) has the molecular formula C30H28FN9O2 and a molecular weight of 565.61 g/mol. Its IUPAC name is N'-[4-[4-[[6-(3-but-2-ynoyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[3,2-d]pyrimidin-4-yl]amino]-3-fluoro-2-methylphenoxy]-2-pyridinyl]methanimidamide.
| Compound Name | N'-[4-[4-[[6-(3-but-2-ynoyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[3,2-d]pyrimidin-4-yl]amino]-3-fluoro-2-methylphenoxy]-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 166544075 |
| Molecular Formula | C30H28FN9O2 |
| Molecular Weight | 565.61 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | N'-[4-[4-[[6-(3-but-2-ynoyl-3,8-diazabicyclo[3.2.1]octan-8-yl)pyrido[3,2-d]pyrimidin-4-yl]amino]-3-fluoro-2-methylphenoxy]-2-pyridinyl]methanimidamide |
| SMILES | CC#CC(=O)N1CC2CCC(C1)N2c1ccc2ncnc(Nc3ccc(Oc4ccnc(/N=C/N)c4)c(C)c3F)c2n1 |
| InChI | InChI=1S/C30H28FN9O2/c1-3-4-27(41)39-14-19-5-6-20(15-39)40(19)26-10-8-23-29(38-26)30(36-17-35-23)37-22-7-9-24(18(2)28(22)31)42-21-11-12-33-25(13-21)34-16-32/h7-13,16-17,19-20H,5-6,14-15H2,1-2H3,(H2,32,33,34)(H,35,36,37) |
| InChIKey | VPFMPPFNKNPNEI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|