C31H27FN8O2 — CID 166543982
1-[(1R,5S)-3-[4-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-8-azabicyclo[3.2.1]octan-8-yl]but-2-yn-1-one (PubChem CID 166543982) has the molecular formula C31H27FN8O2 and a molecular weight of 562.61 g/mol. Its IUPAC name is 1-[(1R,5S)-3-[4-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-8-azabicyclo[3.2.1]octan-8-yl]but-2-yn-1-one.
| Compound Name | 1-[(1R,5S)-3-[4-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-8-azabicyclo[3.2.1]octan-8-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 166543982 |
| Molecular Formula | C31H27FN8O2 |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 1-[(1R,5S)-3-[4-[2-fluoro-5-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]pyrido[3,2-d]pyrimidin-6-yl]-8-azabicyclo[3.2.1]octan-8-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1[C@@H]2CC[C@H]1CC(c1ccc3ncnc(Nc4cc(C)c(Oc5ccn6ncnc6c5)cc4F)c3n1)C2 |
| InChI | InChI=1S/C31H27FN8O2/c1-3-4-29(41)40-20-5-6-21(40)13-19(12-20)24-7-8-25-30(37-24)31(35-16-33-25)38-26-11-18(2)27(15-23(26)32)42-22-9-10-39-28(14-22)34-17-36-39/h7-11,14-17,19-21H,5-6,12-13H2,1-2H3,(H,33,35,38)/t19?,20-,21+ |
| InChIKey | NIAFYUGAXLYAPF-SEJPIABJSA-N |
| XLogP | 5.31 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|