C22H39N — CID 166540706
(4E,6Z,8E,12Z)-N-hexyl-3-methylpentadeca-4,6,8,12-tetraen-1-amine (PubChem CID 166540706) has the molecular formula C22H39N and a molecular weight of 317.56 g/mol. Its IUPAC name is (4E,6Z,8E,12Z)-N-hexyl-3-methylpentadeca-4,6,8,12-tetraen-1-amine.
| Compound Name | (4E,6Z,8E,12Z)-N-hexyl-3-methylpentadeca-4,6,8,12-tetraen-1-amine |
|---|---|
| PubChem CID | 166540706 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | (4E,6Z,8E,12Z)-N-hexyl-3-methylpentadeca-4,6,8,12-tetraen-1-amine |
| SMILES | CC/C=C\CC/C=C/C=C\C=C\C(C)CCNCCCCCC |
| InChI | InChI=1S/C22H39N/c1-4-6-8-10-11-12-13-14-15-16-18-22(3)19-21-23-20-17-9-7-5-2/h6,8,12-16,18,22-23H,4-5,7,9-11,17,19-21H2,1-3H3/b8-6-,13-12+,15-14-,18-16+ |
| InChIKey | VKQXTORPDNKKTQ-MENLOLNYSA-N |
| XLogP | 6.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|