C18H31N5O — CID 166542535
1-[4-[1-(2-azaspiro[3.3]heptan-6-yl)-5-methylpyrazol-3-yl]piperazin-1-yl]ethanone;ethane (PubChem CID 166542535) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[4-[1-(2-azaspiro[3.3]heptan-6-yl)-5-methylpyrazol-3-yl]piperazin-1-yl]ethanone;ethane.
| Compound Name | 1-[4-[1-(2-azaspiro[3.3]heptan-6-yl)-5-methylpyrazol-3-yl]piperazin-1-yl]ethanone;ethane |
|---|---|
| PubChem CID | 166542535 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 1-[4-[1-(2-azaspiro[3.3]heptan-6-yl)-5-methylpyrazol-3-yl]piperazin-1-yl]ethanone;ethane |
| SMILES | CC.CC(=O)N1CCN(c2cc(C)n(C3CC4(CNC4)C3)n2)CC1 |
| InChI | InChI=1S/C16H25N5O.C2H6/c1-12-7-15(20-5-3-19(4-6-20)13(2)22)18-21(12)14-8-16(9-14)10-17-11-16;1-2/h7,14,17H,3-6,8-11H2,1-2H3;1-2H3 |
| InChIKey | YQVYXOCZVOWEJY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |