C29H50BN5O3 — CID 166543608
CID 166543608 (PubChem CID 166543608) has the molecular formula C29H50BN5O3 and a molecular weight of 527.56 g/mol.
| Compound Name | CID 166543608 |
|---|---|
| PubChem CID | 166543608 |
| Molecular Formula | C29H50BN5O3 |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.40 |
| IUPAC Name | — |
| SMILES | CC.Cc1cc(N2CCC3(CC(=O)N(C)C3)CC2(C)C)nn1C1CC2(C1)CN(C(=O)OC(C)(C)C)C2.[B]C |
| InChI | InChI=1S/C26H41N5O3.C2H6.CH3B/c1-18-10-20(30-9-8-25(14-24(30,5)6)13-21(32)28(7)15-25)27-31(18)19-11-26(12-19)16-29(17-26)22(33)34-23(2,3)4;2*1-2/h10,19H,8-9,11-17H2,1-7H3;1-2H3;1H3 |
| InChIKey | NNMOOHXJIWAMJO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 70.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|