C25H44N4O4 — CID 167265121
tert-butyl 4-[3-(4,4-diethoxy-2,2-dimethylpiperidin-1-yl)-5-methylpyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 167265121) has the molecular formula C25H44N4O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is tert-butyl 4-[3-(4,4-diethoxy-2,2-dimethylpiperidin-1-yl)-5-methylpyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(4,4-diethoxy-2,2-dimethylpiperidin-1-yl)-5-methylpyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167265121 |
| Molecular Formula | C25H44N4O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.34 |
| IUPAC Name | tert-butyl 4-[3-(4,4-diethoxy-2,2-dimethylpiperidin-1-yl)-5-methylpyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC1(OCC)CCN(c2cc(C)n(C3CCN(C(=O)OC(C)(C)C)CC3)n2)C(C)(C)C1 |
| InChI | InChI=1S/C25H44N4O4/c1-9-31-25(32-10-2)13-16-28(24(7,8)18-25)21-17-19(3)29(26-21)20-11-14-27(15-12-20)22(30)33-23(4,5)6/h17,20H,9-16,18H2,1-8H3 |
| InChIKey | SRBCHGNGINNIIJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|