C18H28BN5 — CID 166542795
CID 166542795 (PubChem CID 166542795) has the molecular formula C18H28BN5 and a molecular weight of 325.27 g/mol.
| Compound Name | CID 166542795 |
|---|---|
| PubChem CID | 166542795 |
| Molecular Formula | C18H28BN5 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | — |
| SMILES | [B]N1CCN(c2nn(C3CC4(CNC4)C3)c(C)c2C)C2(CCC2)C1 |
| InChI | InChI=1S/C18H28BN5/c1-13-14(2)24(15-8-17(9-15)10-20-11-17)21-16(13)23-7-6-22(19)12-18(23)4-3-5-18/h15,20H,3-12H2,1-2H3 |
| InChIKey | OYVDCUSXMKTURG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|