C31H29FN8O2 — CID 166544176
1-[(1R,4S,6R)-6-[4-[2-fluoro-5-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one (PubChem CID 166544176) has the molecular formula C31H29FN8O2 and a molecular weight of 564.63 g/mol. Its IUPAC name is 1-[(1R,4S,6R)-6-[4-[2-fluoro-5-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,4S,6R)-6-[4-[2-fluoro-5-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166544176 |
| Molecular Formula | C31H29FN8O2 |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 1-[(1R,4S,6R)-6-[4-[2-fluoro-5-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-2-azabicyclo[2.2.2]octan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H]2CC[C@@H]1[C@H](c1ccc3ncnc(Nc4cc(C)c(Oc5cnc6c(c5)ncn6C)cc4F)c3n1)C2 |
| InChI | InChI=1S/C31H29FN8O2/c1-4-28(41)40-14-18-5-8-26(40)20(10-18)22-6-7-23-29(37-22)30(35-15-34-23)38-24-9-17(2)27(12-21(24)32)42-19-11-25-31(33-13-19)39(3)16-36-25/h4,6-7,9,11-13,15-16,18,20,26H,1,5,8,10,14H2,2-3H3,(H,34,35,38)/t18-,20-,26+/m0/s1 |
| InChIKey | VIUXGEVKMBPWLE-STTRJGPESA-N |
| XLogP | 5.57 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|