C30H28N8O2 — CID 170984032
1-[(1R,2S,4S)-2-[4-[3-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-7-azabicyclo[2.2.1]heptan-7-yl]prop-2-en-1-one (PubChem CID 170984032) has the molecular formula C30H28N8O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-[4-[3-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-7-azabicyclo[2.2.1]heptan-7-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,2S,4S)-2-[4-[3-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-7-azabicyclo[2.2.1]heptan-7-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170984032 |
| Molecular Formula | C30H28N8O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 1-[(1R,2S,4S)-2-[4-[3-methyl-4-(3-methylimidazo[4,5-b]pyridin-6-yl)oxyanilino]pyrido[3,2-d]pyrimidin-6-yl]-7-azabicyclo[2.2.1]heptan-7-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1[C@H]2CC[C@@H]1[C@@H](c1ccc3ncnc(Nc4ccc(Oc5cnc6c(c5)ncn6C)c(C)c4)c3n1)C2 |
| InChI | InChI=1S/C30H28N8O2/c1-4-27(39)38-19-6-9-25(38)21(12-19)22-7-8-23-28(36-22)29(33-15-32-23)35-18-5-10-26(17(2)11-18)40-20-13-24-30(31-14-20)37(3)16-34-24/h4-5,7-8,10-11,13-16,19,21,25H,1,6,9,12H2,2-3H3,(H,32,33,35)/t19-,21+,25+/m0/s1 |
| InChIKey | PHYJTUFZJFCEMD-PIBDYAPNSA-N |
| XLogP | 5.18 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|