C15H16ClF2N3 — CID 166547087
6-chloro-1-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine (PubChem CID 166547087) has the molecular formula C15H16ClF2N3 and a molecular weight of 311.76 g/mol. Its IUPAC name is 6-chloro-1-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine.
| Compound Name | 6-chloro-1-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine |
|---|---|
| PubChem CID | 166547087 |
| Molecular Formula | C15H16ClF2N3 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 6-chloro-1-[(3R,4R)-3,4-difluoropyrrolidin-1-yl]-4-propan-2-yl-2,7-naphthyridine |
| SMILES | CC(C)c1cnc(N2C[C@@H](F)[C@H](F)C2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C15H16ClF2N3/c1-8(2)10-4-20-15(21-6-12(17)13(18)7-21)11-5-19-14(16)3-9(10)11/h3-5,8,12-13H,6-7H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | DPMABNBCMMPBGU-CHWSQXEVSA-N |
| XLogP | 3.90 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|