C25H20F3N7O — CID 166547835
2,2-dimethyl-4-[1-[3-methyl-12-(trifluoromethyl)-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl]-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]but-3-ynenitrile (PubChem CID 166547835) has the molecular formula C25H20F3N7O and a molecular weight of 491.48 g/mol. Its IUPAC name is 2,2-dimethyl-4-[1-[3-methyl-12-(trifluoromethyl)-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl]-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]but-3-ynenitrile.
| Compound Name | 2,2-dimethyl-4-[1-[3-methyl-12-(trifluoromethyl)-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl]-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]but-3-ynenitrile |
|---|---|
| PubChem CID | 166547835 |
| Molecular Formula | C25H20F3N7O |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2,2-dimethyl-4-[1-[3-methyl-12-(trifluoromethyl)-2,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-8-yl]-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]but-3-ynenitrile |
| SMILES | Cc1nnc2nc(N3CCOCc4c(C#CC(C)(C)C#N)cccc43)c3ccc(C(F)(F)F)nc3n12 |
| InChI | InChI=1S/C25H20F3N7O/c1-15-32-33-23-31-21(17-7-8-20(25(26,27)28)30-22(17)35(15)23)34-11-12-36-13-18-16(5-4-6-19(18)34)9-10-24(2,3)14-29/h4-8H,11-13H2,1-3H3 |
| InChIKey | PZYIIJISJSEWKE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|