C29H31FN6O3 — CID 166549278
tert-butyl N-[4-[1-(6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2-methylbut-3-yn-2-yl]carbamate (PubChem CID 166549278) has the molecular formula C29H31FN6O3 and a molecular weight of 530.60 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2-methylbut-3-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2-methylbut-3-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 166549278 |
| Molecular Formula | C29H31FN6O3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | tert-butyl N-[4-[1-(6-fluoro-1-methyl-[1,2,4]triazolo[4,3-a]quinazolin-5-yl)-3,5-dihydro-2H-4,1-benzoxazepin-6-yl]-2-methylbut-3-yn-2-yl]carbamate |
| SMILES | Cc1nnc2nc(N3CCOCc4c(C#CC(C)(C)NC(=O)OC(C)(C)C)cccc43)c3c(F)cccc3n12 |
| InChI | InChI=1S/C29H31FN6O3/c1-18-33-34-26-31-25(24-21(30)10-8-12-23(24)36(18)26)35-15-16-38-17-20-19(9-7-11-22(20)35)13-14-29(5,6)32-27(37)39-28(2,3)4/h7-12H,15-17H2,1-6H3,(H,32,37) |
| InChIKey | VXLWRMFXPJSCOG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|