C30H34B3FN4O4 — CID 166548214
CID 166548214 (PubChem CID 166548214) has the molecular formula C30H34B3FN4O4 and a molecular weight of 566.06 g/mol.
| Compound Name | CID 166548214 |
|---|---|
| PubChem CID | 166548214 |
| Molecular Formula | C30H34B3FN4O4 |
| Molecular Weight | 566.06 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | — |
| SMILES | CC.[B]C([B])([B])n1c(=O)nc(N2CCOCc3c(C#CC(C)(C)NC(=O)OC(C)(C)C)cccc32)c2c(F)cccc21 |
| InChI | InChI=1S/C28H28B3FN4O4.C2H6/c1-26(2,3)40-25(38)34-27(4,5)13-12-17-8-6-10-20-18(17)16-39-15-14-35(20)23-22-19(32)9-7-11-21(22)36(24(37)33-23)28(29,30)31;1-2/h6-11H,14-16H2,1-5H3,(H,34,38);1-2H3 |
| InChIKey | PDKVSLOGISAFHY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|