C25H21B3FN3O — CID 166548395
CID 166548395 (PubChem CID 166548395) has the molecular formula C25H21B3FN3O and a molecular weight of 430.90 g/mol.
| Compound Name | CID 166548395 |
|---|---|
| PubChem CID | 166548395 |
| Molecular Formula | C25H21B3FN3O |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])n1c(=O)nc(N2CCCCc3c(C#CC4(C)CC4)cccc32)c2c(F)cccc21 |
| InChI | InChI=1S/C25H21B3FN3O/c1-24(13-14-24)12-11-16-6-4-9-19-17(16)7-2-3-15-31(19)22-21-18(29)8-5-10-20(21)32(23(33)30-22)25(26,27)28/h4-6,8-10H,2-3,7,13-15H2,1H3 |
| InChIKey | VCPNQFSPIXYDPH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|