C25H23F2N5 — CID 156800548
1-ethanimidoyl-5,7-difluoro-4-[5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-quinolin-1-yl]quinazolin-2-imine (PubChem CID 156800548) has the molecular formula C25H23F2N5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-ethanimidoyl-5,7-difluoro-4-[5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-quinolin-1-yl]quinazolin-2-imine.
| Compound Name | 1-ethanimidoyl-5,7-difluoro-4-[5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-quinolin-1-yl]quinazolin-2-imine |
|---|---|
| PubChem CID | 156800548 |
| Molecular Formula | C25H23F2N5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-ethanimidoyl-5,7-difluoro-4-[5-[2-(1-methylcyclopropyl)ethynyl]-3,4-dihydro-2H-quinolin-1-yl]quinazolin-2-imine |
| SMILES | [H]/N=C(\C)n1/c(=N/[H])nc(N2CCCc3c(C#CC4(C)CC4)cccc32)c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C25H23F2N5/c1-15(28)32-21-14-17(26)13-19(27)22(21)23(30-24(32)29)31-12-4-6-18-16(5-3-7-20(18)31)8-9-25(2)10-11-25/h3,5,7,13-14,28-29H,4,6,10-12H2,1-2H3/b28-15+,29-24+ |
| InChIKey | QLKLHVGKRSISRN-ZXKSSVDBSA-N |
| XLogP | 4.88 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|