C20H20FN5 — CID 156800234
1-ethanimidoyl-6-fluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine (PubChem CID 156800234) has the molecular formula C20H20FN5 and a molecular weight of 349.41 g/mol. Its IUPAC name is 1-ethanimidoyl-6-fluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine.
| Compound Name | 1-ethanimidoyl-6-fluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine |
|---|---|
| PubChem CID | 156800234 |
| Molecular Formula | C20H20FN5 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-ethanimidoyl-6-fluoro-4-(5-methyl-3,4-dihydro-2H-quinolin-1-yl)quinazolin-2-imine |
| SMILES | [H]/N=C(\C)n1/c(=N/[H])nc(N2CCCc3c(C)cccc32)c2cc(F)ccc21 |
| InChI | InChI=1S/C20H20FN5/c1-12-5-3-7-17-15(12)6-4-10-25(17)19-16-11-14(21)8-9-18(16)26(13(2)22)20(23)24-19/h3,5,7-9,11,22-23H,4,6,10H2,1-2H3/b22-13+,23-20+ |
| InChIKey | KJXUWVOVBVINRE-GBXVRFTQSA-N |
| XLogP | 3.89 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|