C19H18F3N5 — CID 156800504
N-(2,2-difluoroethyl)-1-ethanimidoyl-6-fluoro-2-imino-N-(3-methylphenyl)quinazolin-4-amine (PubChem CID 156800504) has the molecular formula C19H18F3N5 and a molecular weight of 373.38 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-ethanimidoyl-6-fluoro-2-imino-N-(3-methylphenyl)quinazolin-4-amine.
| Compound Name | N-(2,2-difluoroethyl)-1-ethanimidoyl-6-fluoro-2-imino-N-(3-methylphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 156800504 |
| Molecular Formula | C19H18F3N5 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-ethanimidoyl-6-fluoro-2-imino-N-(3-methylphenyl)quinazolin-4-amine |
| SMILES | [H]/N=C(\C)n1/c(=N/[H])nc(N(CC(F)F)c2cccc(C)c2)c2cc(F)ccc21 |
| InChI | InChI=1S/C19H18F3N5/c1-11-4-3-5-14(8-11)26(10-17(21)22)18-15-9-13(20)6-7-16(15)27(12(2)23)19(24)25-18/h3-9,17,23-24H,10H2,1-2H3/b23-12+,24-19+ |
| InChIKey | DADGMDUUMWYQBN-XTFZMBPOSA-N |
| XLogP | 4.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|