C24H24FN7 — CID 166547991
4-[1-[3-amino-4-[amino(methyl)amino]-8-fluoroisoquinolin-1-yl]-3,4-dihydro-2H-1,7-naphthyridin-5-yl]-2,2-dimethylbut-3-ynenitrile (PubChem CID 166547991) has the molecular formula C24H24FN7 and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-[1-[3-amino-4-[amino(methyl)amino]-8-fluoroisoquinolin-1-yl]-3,4-dihydro-2H-1,7-naphthyridin-5-yl]-2,2-dimethylbut-3-ynenitrile.
| Compound Name | 4-[1-[3-amino-4-[amino(methyl)amino]-8-fluoroisoquinolin-1-yl]-3,4-dihydro-2H-1,7-naphthyridin-5-yl]-2,2-dimethylbut-3-ynenitrile |
|---|---|
| PubChem CID | 166547991 |
| Molecular Formula | C24H24FN7 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 4-[1-[3-amino-4-[amino(methyl)amino]-8-fluoroisoquinolin-1-yl]-3,4-dihydro-2H-1,7-naphthyridin-5-yl]-2,2-dimethylbut-3-ynenitrile |
| SMILES | CN(N)c1c(N)nc(N2CCCc3c(C#CC(C)(C)C#N)cncc32)c2c(F)cccc12 |
| InChI | InChI=1S/C24H24FN7/c1-24(2,14-26)10-9-15-12-29-13-19-16(15)7-5-11-32(19)23-20-17(6-4-8-18(20)25)21(31(3)28)22(27)30-23/h4,6,8,12-13H,5,7,11,28H2,1-3H3,(H2,27,30) |
| InChIKey | BOGHVDIUWLVGBN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|