C19H27NO — CID 166548216
6-(2-cyclopropylethynyl)-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine;ethane (PubChem CID 166548216) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 6-(2-cyclopropylethynyl)-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine;ethane.
| Compound Name | 6-(2-cyclopropylethynyl)-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine;ethane |
|---|---|
| PubChem CID | 166548216 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 6-(2-cyclopropylethynyl)-1-propan-2-yl-3,5-dihydro-2H-4,1-benzoxazepine;ethane |
| SMILES | CC.CC(C)N1CCOCc2c(C#CC3CC3)cccc21 |
| InChI | InChI=1S/C17H21NO.C2H6/c1-13(2)18-10-11-19-12-16-15(4-3-5-17(16)18)9-8-14-6-7-14;1-2/h3-5,13-14H,6-7,10-12H2,1-2H3;1-2H3 |
| InChIKey | UZZFSEVDNVJIMG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|