C12H15F2N — CID 166548662
N-[[3-(difluoromethyl)-2-methylphenyl]methyl]prop-1-en-2-amine (PubChem CID 166548662) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)-2-methylphenyl]methyl]prop-1-en-2-amine.
| Compound Name | N-[[3-(difluoromethyl)-2-methylphenyl]methyl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 166548662 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-[[3-(difluoromethyl)-2-methylphenyl]methyl]prop-1-en-2-amine |
| SMILES | C=C(C)NCc1cccc(C(F)F)c1C |
| InChI | InChI=1S/C12H15F2N/c1-8(2)15-7-10-5-4-6-11(9(10)3)12(13)14/h4-6,12,15H,1,7H2,2-3H3 |
| InChIKey | VVNUBOZSMPEKMB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |