C18H14N6 — CID 166549463
4-[(2,4-diaminopyrrolo[2,3-h]quinazolin-7-yl)methyl]benzonitrile (PubChem CID 166549463) has the molecular formula C18H14N6 and a molecular weight of 314.35 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrrolo[2,3-h]quinazolin-7-yl)methyl]benzonitrile.
| Compound Name | 4-[(2,4-diaminopyrrolo[2,3-h]quinazolin-7-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 166549463 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-[(2,4-diaminopyrrolo[2,3-h]quinazolin-7-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(Cn2ccc3c4nc(N)nc(N)c4ccc32)cc1 |
| InChI | InChI=1S/C18H14N6/c19-9-11-1-3-12(4-2-11)10-24-8-7-13-15(24)6-5-14-16(13)22-18(21)23-17(14)20/h1-8H,10H2,(H4,20,21,22,23) |
| InChIKey | IPJZZHWLDKDSAL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |