C19H15N5 — CID 162432139
7-[(4-ethynylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 162432139) has the molecular formula C19H15N5 and a molecular weight of 313.36 g/mol. Its IUPAC name is 7-[(4-ethynylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine.
| Compound Name | 7-[(4-ethynylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine |
|---|---|
| PubChem CID | 162432139 |
| Molecular Formula | C19H15N5 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 7-[(4-ethynylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | C#Cc1ccc(Cn2ccc3c4c(N)nc(N)nc4ccc32)cc1 |
| InChI | InChI=1S/C19H15N5/c1-2-12-3-5-13(6-4-12)11-24-10-9-14-16(24)8-7-15-17(14)18(20)23-19(21)22-15/h1,3-10H,11H2,(H4,20,21,22,23) |
| InChIKey | KXLQOTMVVDEPTO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|