C16H14N6 — CID 44531949
7-(pyridin-2-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 44531949) has the molecular formula C16H14N6 and a molecular weight of 290.33 g/mol. Its IUPAC name is 7-(pyridin-2-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine.
| Compound Name | 7-(pyridin-2-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine |
|---|---|
| PubChem CID | 44531949 |
| Molecular Formula | C16H14N6 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 7-(pyridin-2-ylmethyl)pyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | Nc1nc(N)c2c(ccc3c2ccn3Cc2ccccn2)n1 |
| InChI | InChI=1S/C16H14N6/c17-15-14-11-6-8-22(9-10-3-1-2-7-19-10)13(11)5-4-12(14)20-16(18)21-15/h1-8H,9H2,(H4,17,18,20,21) |
| InChIKey | SVKZTQKOMJSARQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |