C22H28AsFN7O — CID 166549840
CID 166549840 (PubChem CID 166549840) has the molecular formula C22H28AsFN7O and a molecular weight of 500.43 g/mol.
| Compound Name | CID 166549840 |
|---|---|
| PubChem CID | 166549840 |
| Molecular Formula | C22H28AsFN7O |
| Molecular Weight | 500.43 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | — |
| SMILES | CNc1ncc(C(C)C)c2cc(Nc3ccnc(N4CC[C@@H](O)[C@@](F)([As]C)C4)n3)ncc12 |
| InChI | InChI=1S/C22H28AsFN7O/c1-13(2)15-10-28-20(25-4)16-11-27-19(9-14(15)16)29-18-5-7-26-21(30-18)31-8-6-17(32)22(24,12-31)23-3/h5,7,9-11,13,17,32H,6,8,12H2,1-4H3,(H,25,28)(H,26,27,29,30)/t17-,22-/m1/s1 |
| InChIKey | UHZNBKSULRCGOF-VGOFRKELSA-N |
| XLogP | 3.32 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|