C23H30AsFN7O — CID 166549936
CID 166549936 (PubChem CID 166549936) has the molecular formula C23H30AsFN7O and a molecular weight of 514.46 g/mol.
| Compound Name | CID 166549936 |
|---|---|
| PubChem CID | 166549936 |
| Molecular Formula | C23H30AsFN7O |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | — |
| SMILES | CNc1ncc(C(C)C)c2cc(Nc3ccnc(N4CC[C@@](O)([As]C)[C@@](C)(F)C4)n3)ncc12 |
| InChI | InChI=1S/C23H30AsFN7O/c1-14(2)16-11-29-20(26-5)17-12-28-19(10-15(16)17)30-18-6-8-27-21(31-18)32-9-7-23(33,24-4)22(3,25)13-32/h6,8,10-12,14,33H,7,9,13H2,1-5H3,(H,26,29)(H,27,28,30,31)/t22-,23-/m0/s1 |
| InChIKey | HQIHPKOFYVLNLX-GOTSBHOMSA-N |
| XLogP | 3.71 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|