C26H30N8O2 — CID 166550085
N-[2-(2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)pyrimidin-4-yl]-5-propan-2-yl-8-[2-(1,2,4-triazol-4-yl)ethoxy]isoquinolin-3-amine (PubChem CID 166550085) has the molecular formula C26H30N8O2 and a molecular weight of 486.58 g/mol. Its IUPAC name is N-[2-(2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)pyrimidin-4-yl]-5-propan-2-yl-8-[2-(1,2,4-triazol-4-yl)ethoxy]isoquinolin-3-amine.
| Compound Name | N-[2-(2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)pyrimidin-4-yl]-5-propan-2-yl-8-[2-(1,2,4-triazol-4-yl)ethoxy]isoquinolin-3-amine |
|---|---|
| PubChem CID | 166550085 |
| Molecular Formula | C26H30N8O2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | N-[2-(2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)pyrimidin-4-yl]-5-propan-2-yl-8-[2-(1,2,4-triazol-4-yl)ethoxy]isoquinolin-3-amine |
| SMILES | CC(C)c1ccc(OCCn2cnnc2)c2cnc(Nc3ccnc(N4CCC5COCC54)n3)cc12 |
| InChI | InChI=1S/C26H30N8O2/c1-17(2)19-3-4-23(36-10-9-33-15-29-30-16-33)21-12-28-25(11-20(19)21)31-24-5-7-27-26(32-24)34-8-6-18-13-35-14-22(18)34/h3-5,7,11-12,15-18,22H,6,8-10,13-14H2,1-2H3,(H,27,28,31,32) |
| InChIKey | YDTCOHSQSPEPAK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |