C14H19F3N2 — CID 166552631
(4E)-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,4,6-trien-3-imine (PubChem CID 166552631) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (4E)-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,4,6-trien-3-imine.
| Compound Name | (4E)-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,4,6-trien-3-imine |
|---|---|
| PubChem CID | 166552631 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (4E)-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]hepta-1,4,6-trien-3-imine |
| SMILES | [H]/N=C(C(=C)C)/C(=C\C=C)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F3N2/c1-4-5-12(13(18)10(2)3)19-8-6-11(7-9-19)14(15,16)17/h4-5,11,18H,1-2,6-9H2,3H3/b12-5+,18-13+ |
| InChIKey | YMMYJFNQYLACQR-OTSMZNQDSA-N |
| XLogP | 3.93 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|