C22H32N4O5 — CID 166554045
2-(3-methoxy-4-propan-2-yloxybenzoyl)-N-[2-(methylamino)-2-oxoethyl]-1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridine-7-carboxamide (PubChem CID 166554045) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-(3-methoxy-4-propan-2-yloxybenzoyl)-N-[2-(methylamino)-2-oxoethyl]-1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridine-7-carboxamide.
| Compound Name | 2-(3-methoxy-4-propan-2-yloxybenzoyl)-N-[2-(methylamino)-2-oxoethyl]-1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 166554045 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-(3-methoxy-4-propan-2-yloxybenzoyl)-N-[2-(methylamino)-2-oxoethyl]-1,3,3a,4,5,6,7,7a-octahydropyrrolo[3,4-c]pyridine-7-carboxamide |
| SMILES | CNC(=O)CNC(=O)C1CNCC2CN(C(=O)c3ccc(OC(C)C)c(OC)c3)CC21 |
| InChI | InChI=1S/C22H32N4O5/c1-13(2)31-18-6-5-14(7-19(18)30-4)22(29)26-11-15-8-24-9-16(17(15)12-26)21(28)25-10-20(27)23-3/h5-7,13,15-17,24H,8-12H2,1-4H3,(H,23,27)(H,25,28) |
| InChIKey | UPRDCZDVVHVNOD-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |