C38H49ClN4O6S — CID 166554881
tert-butyl N-[9-[4-[4-chloro-2-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]thieno[3,2-b]pyridin-7-yl]-6-methylphenoxy]piperidin-1-yl]-9-oxononyl]carbamate (PubChem CID 166554881) has the molecular formula C38H49ClN4O6S and a molecular weight of 725.35 g/mol. Its IUPAC name is tert-butyl N-[9-[4-[4-chloro-2-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]thieno[3,2-b]pyridin-7-yl]-6-methylphenoxy]piperidin-1-yl]-9-oxononyl]carbamate.
| Compound Name | tert-butyl N-[9-[4-[4-chloro-2-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]thieno[3,2-b]pyridin-7-yl]-6-methylphenoxy]piperidin-1-yl]-9-oxononyl]carbamate |
|---|---|
| PubChem CID | 166554881 |
| Molecular Formula | C38H49ClN4O6S |
| Molecular Weight | 725.35 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | tert-butyl N-[9-[4-[4-chloro-2-[2-[(2,5-dioxopyrrolidin-1-yl)methyl]thieno[3,2-b]pyridin-7-yl]-6-methylphenoxy]piperidin-1-yl]-9-oxononyl]carbamate |
| SMILES | Cc1cc(Cl)cc(-c2ccnc3cc(CN4C(=O)CCC4=O)sc23)c1OC1CCN(C(=O)CCCCCCCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C38H49ClN4O6S/c1-25-21-26(39)22-30(29-14-18-40-31-23-28(50-36(29)31)24-43-33(45)12-13-34(43)46)35(25)48-27-15-19-42(20-16-27)32(44)11-9-7-5-6-8-10-17-41-37(47)49-38(2,3)4/h14,18,21-23,27H,5-13,15-17,19-20,24H2,1-4H3,(H,41,47) |
| InChIKey | GZNZALBGGWKTCY-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.35 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|