C32H40N4O6S — CID 166555386
tert-butyl N-[2-[3-[3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-oxothieno[3,2-d]pyrimidin-7-yl]prop-2-ynoxy]ethyl]carbamate (PubChem CID 166555386) has the molecular formula C32H40N4O6S and a molecular weight of 608.76 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-oxothieno[3,2-d]pyrimidin-7-yl]prop-2-ynoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-oxothieno[3,2-d]pyrimidin-7-yl]prop-2-ynoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166555386 |
| Molecular Formula | C32H40N4O6S |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | tert-butyl N-[2-[3-[3-[[4-hydroxy-1-[(3R)-3-phenylbutanoyl]piperidin-4-yl]methyl]-4-oxothieno[3,2-d]pyrimidin-7-yl]prop-2-ynoxy]ethyl]carbamate |
| SMILES | C[C@H](CC(=O)N1CCC(O)(Cn2cnc3c(C#CCOCCNC(=O)OC(C)(C)C)csc3c2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C32H40N4O6S/c1-23(24-9-6-5-7-10-24)19-26(37)35-15-12-32(40,13-16-35)21-36-22-34-27-25(20-43-28(27)29(36)38)11-8-17-41-18-14-33-30(39)42-31(2,3)4/h5-7,9-10,20,22-23,40H,12-19,21H2,1-4H3,(H,33,39)/t23-/m1/s1 |
| InChIKey | LQYPULGMQIKBDM-HSZRJFAPSA-N |
| XLogP | 3.90 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|