C22H17F3N6O3 — CID 166556968
N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-3-[1-methyl-4-(4-methyl-1,2,4-triazol-3-yl)pyrazol-5-yl]benzamide (PubChem CID 166556968) has the molecular formula C22H17F3N6O3 and a molecular weight of 470.41 g/mol. Its IUPAC name is N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-3-[1-methyl-4-(4-methyl-1,2,4-triazol-3-yl)pyrazol-5-yl]benzamide.
| Compound Name | N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-3-[1-methyl-4-(4-methyl-1,2,4-triazol-3-yl)pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 166556968 |
| Molecular Formula | C22H17F3N6O3 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[5-formyl-2-hydroxy-3-(trifluoromethyl)phenyl]-3-[1-methyl-4-(4-methyl-1,2,4-triazol-3-yl)pyrazol-5-yl]benzamide |
| SMILES | Cn1cnnc1-c1cnn(C)c1-c1cccc(C(=O)Nc2cc(C=O)cc(C(F)(F)F)c2O)c1 |
| InChI | InChI=1S/C22H17F3N6O3/c1-30-11-26-29-20(30)15-9-27-31(2)18(15)13-4-3-5-14(8-13)21(34)28-17-7-12(10-32)6-16(19(17)33)22(23,24)25/h3-11,33H,1-2H3,(H,28,34) |
| InChIKey | SVSBUNADKJMQES-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|