C23H21F3N4O2Si — CID 166557272
CID 166557272 (PubChem CID 166557272) has the molecular formula C23H21F3N4O2Si and a molecular weight of 470.53 g/mol.
| Compound Name | CID 166557272 |
|---|---|
| PubChem CID | 166557272 |
| Molecular Formula | C23H21F3N4O2Si |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[Si][C@](c2cccc(-c3nc4cc(CO)cc(C(F)(F)F)c4o3)c2)(c2nncn2C)C1 |
| InChI | InChI=1S/C23H21F3N4O2Si/c1-13-9-22(33-11-13,21-29-27-12-30(21)2)16-5-3-4-15(8-16)20-28-18-7-14(10-31)6-17(19(18)32-20)23(24,25)26/h3-8,12-13,31H,9-11H2,1-2H3/t13-,22+/m0/s1 |
| InChIKey | ULFGYSKCPYLJGP-WHEQGISXSA-N |
| XLogP | 4.54 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|