C12H14BN3 — CID 166557762
CID 166557762 (PubChem CID 166557762) has the molecular formula C12H14BN3 and a molecular weight of 211.08 g/mol.
| Compound Name | CID 166557762 |
|---|---|
| PubChem CID | 166557762 |
| Molecular Formula | C12H14BN3 |
| Molecular Weight | 211.08 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | — |
| SMILES | [B]c1cccc([C@H](C)Cc2nncn2C)c1 |
| InChI | InChI=1S/C12H14BN3/c1-9(6-12-15-14-8-16(12)2)10-4-3-5-11(13)7-10/h3-5,7-9H,6H2,1-2H3/t9-/m1/s1 |
| InChIKey | WFYYHXKNZTXKIF-SECBINFHSA-N |
| XLogP | 0.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.08 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|